C15H30IN5O4S — CID 111328217
ethyl 4-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328217) has the molecular formula C15H30IN5O4S and a molecular weight of 503.41 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328217 |
| Molecular Formula | C15H30IN5O4S |
| Molecular Weight | 503.41 g/mol |
| Exact Mass | 503.11 |
| IUPAC Name | ethyl 4-[[N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCN2CCCS2(=O)=O)CC1.I |
| InChI | InChI=1S/C15H29N5O4S.HI/c1-3-24-15(21)19-9-5-13(6-10-19)18-14(16-2)17-7-11-20-8-4-12-25(20,22)23;/h13H,3-12H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | NIZHOAFSXDZTTD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|