C13H27IN4O4S — CID 111328647
ethyl 4-[[N'-methyl-N-(2-methylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328647) has the molecular formula C13H27IN4O4S and a molecular weight of 462.35 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-(2-methylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-methyl-N-(2-methylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328647 |
| Molecular Formula | C13H27IN4O4S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-(2-methylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCS(C)(=O)=O)CC1.I |
| InChI | InChI=1S/C13H26N4O4S.HI/c1-4-21-13(18)17-8-5-11(6-9-17)16-12(14-2)15-7-10-22(3,19)20;/h11H,4-10H2,1-3H3,(H2,14,15,16);1H |
| InChIKey | KLAAUPDWTBAHKY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|