C17H33N5O4S — CID 111785070
ethyl 4-[[N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111785070) has the molecular formula C17H33N5O4S and a molecular weight of 403.55 g/mol. Its IUPAC name is ethyl 4-[[N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111785070 |
| Molecular Formula | C17H33N5O4S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | ethyl 4-[[N-[2-(cyclobutylmethylsulfamoyl)ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCS(=O)(=O)NCC2CCC2)CC1 |
| InChI | InChI=1S/C17H33N5O4S/c1-3-26-17(23)22-10-7-15(8-11-22)21-16(18-2)19-9-12-27(24,25)20-13-14-5-4-6-14/h14-15,20H,3-13H2,1-2H3,(H2,18,19,21) |
| InChIKey | RDBXNHRIEWOCBZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|