C19H32IN5O4S — CID 111327625
ethyl 4-[[N'-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111327625) has the molecular formula C19H32IN5O4S and a molecular weight of 553.47 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111327625 |
| Molecular Formula | C19H32IN5O4S |
| Molecular Weight | 553.47 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCNS(=O)(=O)c2ccc(C)cc2)CC1.I |
| InChI | InChI=1S/C19H31N5O4S.HI/c1-4-28-19(25)24-13-9-16(10-14-24)23-18(20-3)21-11-12-22-29(26,27)17-7-5-15(2)6-8-17;/h5-8,16,22H,4,9-14H2,1-3H3,(H2,20,21,23);1H |
| InChIKey | JHPYUQZSIVJCAK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|