C20H32IN5O4 — CID 111328859
ethyl 4-[[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328859) has the molecular formula C20H32IN5O4 and a molecular weight of 533.41 g/mol. Its IUPAC name is ethyl 4-[[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328859 |
| Molecular Formula | C20H32IN5O4 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | ethyl 4-[[N-[2-[(4-methoxybenzoyl)amino]ethyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCNC(=O)c2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C20H31N5O4.HI/c1-4-29-20(27)25-13-9-16(10-14-25)24-19(21-2)23-12-11-22-18(26)15-5-7-17(28-3)8-6-15;/h5-8,16H,4,9-14H2,1-3H3,(H,22,26)(H2,21,23,24);1H |
| InChIKey | YEVBTXIAFMJKIP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|