C20H33IN4O3 — CID 111328019
ethyl 4-[[N-[3-(4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111328019) has the molecular formula C20H33IN4O3 and a molecular weight of 504.41 g/mol. Its IUPAC name is ethyl 4-[[N-[3-(4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[3-(4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111328019 |
| Molecular Formula | C20H33IN4O3 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | ethyl 4-[[N-[3-(4-methoxyphenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCc2ccc(OC)cc2)CC1.I |
| InChI | InChI=1S/C20H32N4O3.HI/c1-4-27-20(25)24-14-11-17(12-15-24)23-19(21-2)22-13-5-6-16-7-9-18(26-3)10-8-16;/h7-10,17H,4-6,11-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | FEOHJZLCTSCQRY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|