C19H30FIN4O2 — CID 111838310
ethyl 4-[[N-[3-(3-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111838310) has the molecular formula C19H30FIN4O2 and a molecular weight of 492.38 g/mol. Its IUPAC name is ethyl 4-[[N-[3-(3-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[3-(3-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111838310 |
| Molecular Formula | C19H30FIN4O2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | ethyl 4-[[N-[3-(3-fluorophenyl)propyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCCCc2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C19H29FN4O2.HI/c1-3-26-19(25)24-12-9-17(10-13-24)23-18(21-2)22-11-5-7-15-6-4-8-16(20)14-15;/h4,6,8,14,17H,3,5,7,9-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | QBASMMDTZCMGSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|