C17H25ClN4O2 — CID 111329740
ethyl 4-[[N-[(3-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111329740) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is ethyl 4-[[N-[(3-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-[(3-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111329740 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl 4-[[N-[(3-chlorophenyl)methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-3-24-17(23)22-9-7-15(8-10-22)21-16(19-2)20-12-13-5-4-6-14(18)11-13/h4-6,11,15H,3,7-10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | NYRUGLFLKTZOKB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|