C19H26ClIN6O3 — CID 111795937
ethyl 4-[[N-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111795937) has the molecular formula C19H26ClIN6O3 and a molecular weight of 548.81 g/mol. Its IUPAC name is ethyl 4-[[N-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111795937 |
| Molecular Formula | C19H26ClIN6O3 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.08 |
| IUPAC Name | ethyl 4-[[N-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N'-methylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/C)NCc2nc(-c3cccc(Cl)c3)no2)CC1.I |
| InChI | InChI=1S/C19H25ClN6O3.HI/c1-3-28-19(27)26-9-7-15(8-10-26)23-18(21-2)22-12-16-24-17(25-29-16)13-5-4-6-14(20)11-13;/h4-6,11,15H,3,7-10,12H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | ICUGYRLOZAFJMJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|