C17H24ClIN6O2 — CID 111612518
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide (PubChem CID 111612518) has the molecular formula C17H24ClIN6O2 and a molecular weight of 506.78 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612518 |
| Molecular Formula | C17H24ClIN6O2 |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCOCC1)NCc1nc(-c2cccc(Cl)c2)no1.I |
| InChI | InChI=1S/C17H23ClN6O2.HI/c1-19-17(20-5-6-24-7-9-25-10-8-24)21-12-15-22-16(23-26-15)13-3-2-4-14(18)11-13;/h2-4,11H,5-10,12H2,1H3,(H2,19,20,21);1H |
| InChIKey | WKOTWJRRCAWHPF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|