C18H26ClIN6O2 — CID 111588298
1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111588298) has the molecular formula C18H26ClIN6O2 and a molecular weight of 520.80 g/mol. Its IUPAC name is 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111588298 |
| Molecular Formula | C18H26ClIN6O2 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCN1CCOCC1)NCCc1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C18H25ClN6O2.HI/c19-15-4-1-3-14(13-15)17-23-16(27-24-17)5-7-22-18(20)21-6-2-8-25-9-11-26-12-10-25;/h1,3-4,13H,2,5-12H2,(H3,20,21,22);1H |
| InChIKey | IASKTMAOSLCZFT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|