C15H20ClN5O — CID 111813808
1-tert-butyl-2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine (PubChem CID 111813808) has the molecular formula C15H20ClN5O and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-tert-butyl-2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine.
| Compound Name | 1-tert-butyl-2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine |
|---|---|
| PubChem CID | 111813808 |
| Molecular Formula | C15H20ClN5O |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-tert-butyl-2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CCc1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C15H20ClN5O/c1-15(2,3)20-14(17)18-8-7-12-19-13(21-22-12)10-5-4-6-11(16)9-10/h4-6,9H,7-8H2,1-3H3,(H3,17,18,20) |
| InChIKey | MTSFLMARKXNKLO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|