C19H21ClIN5O3 — CID 111813767
2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide (PubChem CID 111813767) has the molecular formula C19H21ClIN5O3 and a molecular weight of 529.77 g/mol. Its IUPAC name is 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111813767 |
| Molecular Formula | C19H21ClIN5O3 |
| Molecular Weight | 529.77 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | 2-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-1-(3,4-dimethoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCc2nc(-c3cccc(Cl)c3)no2)cc1OC.I |
| InChI | InChI=1S/C19H20ClN5O3.HI/c1-26-15-7-6-14(11-16(15)27-2)23-19(21)22-9-8-17-24-18(25-28-17)12-4-3-5-13(20)10-12;/h3-7,10-11H,8-9H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | HGEIEBZSSSGUNS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|