C17H16Cl2IN5O2 — CID 111814907
1-(3-chloro-4-methoxyphenyl)-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydroiodide (PubChem CID 111814907) has the molecular formula C17H16Cl2IN5O2 and a molecular weight of 520.16 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814907 |
| Molecular Formula | C17H16Cl2IN5O2 |
| Molecular Weight | 520.16 g/mol |
| Exact Mass | 518.97 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2nc(-c3ccc(Cl)cc3)no2)cc1Cl.I |
| InChI | InChI=1S/C17H15Cl2N5O2.HI/c1-25-14-7-6-12(8-13(14)19)22-17(20)21-9-15-23-16(24-26-15)10-2-4-11(18)5-3-10;/h2-8H,9H2,1H3,(H3,20,21,22);1H |
| InChIKey | UBDAIXQDFYGBRE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.16 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|