C20H23ClIN5O3 — CID 111814891
2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 111814891) has the molecular formula C20H23ClIN5O3 and a molecular weight of 543.79 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814891 |
| Molecular Formula | C20H23ClIN5O3 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2nc(-c3ccc(Cl)cc3)no2)cc1OC.I |
| InChI | InChI=1S/C20H22ClN5O3.HI/c1-27-16-8-3-13(11-17(16)28-2)9-10-23-20(22)24-12-18-25-19(26-29-18)14-4-6-15(21)7-5-14;/h3-8,11H,9-10,12H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | SMXQVVYSEZUPLU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 107.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|