C21H23ClIN5O3 — CID 111612145
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111612145) has the molecular formula C21H23ClIN5O3 and a molecular weight of 555.80 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111612145 |
| Molecular Formula | C21H23ClIN5O3 |
| Molecular Weight | 555.80 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(Cl)cc2)no1)NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C21H22ClN5O3.HI/c1-2-23-21(24-10-9-14-3-8-17-18(11-14)29-13-28-17)25-12-19-26-20(27-30-19)15-4-6-16(22)7-5-15;/h3-8,11H,2,9-10,12-13H2,1H3,(H2,23,24,25);1H |
| InChIKey | PHMRFCJOKDIALL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|