C19H28ClIN6O — CID 111612296
2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111612296) has the molecular formula C19H28ClIN6O and a molecular weight of 518.83 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612296 |
| Molecular Formula | C19H28ClIN6O |
| Molecular Weight | 518.83 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-(2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccc(Cl)cc2)no1)NCCN1CCCCC1.I |
| InChI | InChI=1S/C19H27ClN6O.HI/c1-2-21-19(22-10-13-26-11-4-3-5-12-26)23-14-17-24-18(25-27-17)15-6-8-16(20)9-7-15;/h6-9H,2-5,10-14H2,1H3,(H2,21,22,23);1H |
| InChIKey | AWACAMJKVNENRN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.83 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|