C20H27ClIN7O — CID 111982068
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111982068) has the molecular formula C20H27ClIN7O and a molecular weight of 543.84 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111982068 |
| Molecular Formula | C20H27ClIN7O |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(C)nn(C)c1C)NCCc1nc(-c2ccc(Cl)cc2)no1.I |
| InChI | InChI=1S/C20H26ClN7O.HI/c1-5-22-20(24-12-17-13(2)26-28(4)14(17)3)23-11-10-18-25-19(27-29-18)15-6-8-16(21)9-7-15;/h6-9H,5,10-12H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | FFNMCSZXJUEHFF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|