C20H22ClN5O — CID 111554815
2-benzyl-1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethylguanidine (PubChem CID 111554815) has the molecular formula C20H22ClN5O and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-benzyl-1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethylguanidine.
| Compound Name | 2-benzyl-1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111554815 |
| Molecular Formula | C20H22ClN5O |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-benzyl-1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccccc1)NCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C20H22ClN5O/c1-2-22-20(24-14-15-6-4-3-5-7-15)23-13-12-18-25-19(26-27-18)16-8-10-17(21)11-9-16/h3-11H,2,12-14H2,1H3,(H2,22,23,24) |
| InChIKey | LOMPHXMYMLOCFI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|