C19H21ClIN5O — CID 111554882
1-benzyl-3-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111554882) has the molecular formula C19H21ClIN5O and a molecular weight of 497.77 g/mol. Its IUPAC name is 1-benzyl-3-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-benzyl-3-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111554882 |
| Molecular Formula | C19H21ClIN5O |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 1-benzyl-3-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc(-c2ccc(Cl)cc2)no1)NCc1ccccc1.I |
| InChI | InChI=1S/C19H20ClN5O.HI/c1-21-19(23-13-14-5-3-2-4-6-14)22-12-11-17-24-18(25-26-17)15-7-9-16(20)10-8-15;/h2-10H,11-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | RXYVETSYMPGPCY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|