C20H23ClIN5O — CID 111554944
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[(3-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111554944) has the molecular formula C20H23ClIN5O and a molecular weight of 511.80 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[(3-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[(3-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111554944 |
| Molecular Formula | C20H23ClIN5O |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methyl-3-[(3-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc(-c2ccc(Cl)cc2)no1)NCc1cccc(C)c1.I |
| InChI | InChI=1S/C20H22ClN5O.HI/c1-14-4-3-5-15(12-14)13-24-20(22-2)23-11-10-18-25-19(26-27-18)16-6-8-17(21)9-7-16;/h3-9,12H,10-11,13H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | UIBNARZPRPTUHC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|