C20H21ClIN5O3 — CID 111588248
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111588248) has the molecular formula C20H21ClIN5O3 and a molecular weight of 541.78 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111588248 |
| Molecular Formula | C20H21ClIN5O3 |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(-c2cccc(Cl)c2)no1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C20H20ClN5O3.HI/c1-22-20(24-11-13-5-6-16-17(9-13)28-12-27-16)23-8-7-18-25-19(26-29-18)14-3-2-4-15(21)10-14;/h2-6,9-10H,7-8,11-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | GQNZYKZYJUDCNL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|