C21H25ClIN5O3 — CID 111588342
1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111588342) has the molecular formula C21H25ClIN5O3 and a molecular weight of 557.82 g/mol. Its IUPAC name is 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111588342 |
| Molecular Formula | C21H25ClIN5O3 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 1-[2-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[(3,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nc(-c2cccc(Cl)c2)no1)NCc1ccc(OC)c(OC)c1.I |
| InChI | InChI=1S/C21H24ClN5O3.HI/c1-23-21(25-13-14-7-8-17(28-2)18(11-14)29-3)24-10-9-19-26-20(27-30-19)15-5-4-6-16(22)12-15;/h4-8,11-12H,9-10,13H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | JRXIHKQMNPCLHD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|