C21H25ClIN5O3 — CID 111612408
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide (PubChem CID 111612408) has the molecular formula C21H25ClIN5O3 and a molecular weight of 557.82 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111612408 |
| Molecular Formula | C21H25ClIN5O3 |
| Molecular Weight | 557.82 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(3,4-dimethoxyphenyl)methyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC)c1)NCc1nc(-c2cccc(Cl)c2)no1.I |
| InChI | InChI=1S/C21H24ClN5O3.HI/c1-4-23-21(24-12-14-8-9-17(28-2)18(10-14)29-3)25-13-19-26-20(27-30-19)15-6-5-7-16(22)11-15;/h5-11H,4,12-13H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | NCHPXLBLQNVJEU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|