C20H22ClFIN5O — CID 111612616
2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111612616) has the molecular formula C20H22ClFIN5O and a molecular weight of 529.79 g/mol. Its IUPAC name is 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111612616 |
| Molecular Formula | C20H22ClFIN5O |
| Molecular Weight | 529.79 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2cccc(Cl)c2)no1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C20H21ClFN5O.HI/c1-2-23-20(24-11-10-14-6-3-4-9-17(14)22)25-13-18-26-19(27-28-18)15-7-5-8-16(21)12-15;/h3-9,12H,2,10-11,13H2,1H3,(H2,23,24,25);1H |
| InChIKey | HUMTWEDWVFXIJD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|