C22H23ClN6O — CID 111612479
2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 111612479) has the molecular formula C22H23ClN6O and a molecular weight of 422.92 g/mol. Its IUPAC name is 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111612479 |
| Molecular Formula | C22H23ClN6O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-1-ethyl-3-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(-c2cccc(Cl)c2)no1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H23ClN6O/c1-2-24-22(25-11-10-16-13-26-19-9-4-3-8-18(16)19)27-14-20-28-21(29-30-20)15-6-5-7-17(23)12-15/h3-9,12-13,26H,2,10-11,14H2,1H3,(H2,24,25,27) |
| InChIKey | DYHMQQMSTCSHJO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|