C17H23IN6O — CID 111601939
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111601939) has the molecular formula C17H23IN6O and a molecular weight of 454.32 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111601939 |
| Molecular Formula | C17H23IN6O |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C)n1)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C17H22N6O.HI/c1-3-18-17(21-11-16-22-12(2)24-23-16)19-9-8-13-10-20-15-7-5-4-6-14(13)15;/h4-7,10,20H,3,8-9,11H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | PPSJWWHOJIBXJB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|