C21H27IN4 — CID 110996306
1-ethyl-2-[2-(1H-indol-3-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 110996306) has the molecular formula C21H27IN4 and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-(1H-indol-3-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(1H-indol-3-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110996306 |
| Molecular Formula | C21H27IN4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-ethyl-2-[2-(1H-indol-3-yl)ethyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccccc12)NCCc1ccccc1.I |
| InChI | InChI=1S/C21H26N4.HI/c1-2-22-21(23-14-12-17-8-4-3-5-9-17)24-15-13-18-16-25-20-11-7-6-10-19(18)20;/h3-11,16,25H,2,12-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | KCDFLZKUXHIFME-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|