C20H31N5O — CID 110996545
N-[2-[[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 110996545) has the molecular formula C20H31N5O and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110996545 |
| Molecular Formula | C20H31N5O |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-(1H-indol-3-yl)ethyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCc1c[nH]c2ccccc12)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H31N5O/c1-5-21-19(24-13-12-22-18(26)20(2,3)4)23-11-10-15-14-25-17-9-7-6-8-16(15)17/h6-9,14,25H,5,10-13H2,1-4H3,(H,22,26)(H2,21,23,24) |
| InChIKey | HCJVGJFCWRPUOJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|