C21H32N4O2 — CID 110997171
methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate (PubChem CID 110997171) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate.
| Compound Name | methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate |
|---|---|
| PubChem CID | 110997171 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | methyl 7-[[ethylamino-[2-(1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H32N4O2/c1-3-22-21(23-14-9-5-4-6-12-20(26)27-2)24-15-13-17-16-25-19-11-8-7-10-18(17)19/h7-8,10-11,16,25H,3-6,9,12-15H2,1-2H3,(H2,22,23,24) |
| InChIKey | PUOSBRGGSUSXSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|