C21H32FIN4O2 — CID 111972615
methyl 7-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide (PubChem CID 111972615) has the molecular formula C21H32FIN4O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is methyl 7-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111972615 |
| Molecular Formula | C21H32FIN4O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | methyl 7-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]heptanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCC(=O)OC)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C21H31FN4O2.HI/c1-3-23-21(24-12-7-5-4-6-8-20(27)28-2)25-13-11-16-15-26-19-10-9-17(22)14-18(16)19;/h9-10,14-15,26H,3-8,11-13H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DLZHWGHRVHMCHK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|