C20H29FIN5O — CID 111973267
N-cyclopropyl-4-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]butanamide;hydroiodide (PubChem CID 111973267) has the molecular formula C20H29FIN5O and a molecular weight of 501.39 g/mol. Its IUPAC name is N-cyclopropyl-4-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]butanamide;hydroiodide.
| Compound Name | N-cyclopropyl-4-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]butanamide;hydroiodide |
|---|---|
| PubChem CID | 111973267 |
| Molecular Formula | C20H29FIN5O |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-cyclopropyl-4-[[ethylamino-[2-(5-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]butanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)NC1CC1)NCCc1c[nH]c2ccc(F)cc12.I |
| InChI | InChI=1S/C20H28FN5O.HI/c1-2-22-20(23-10-3-4-19(27)26-16-6-7-16)24-11-9-14-13-25-18-8-5-15(21)12-17(14)18;/h5,8,12-13,16,25H,2-4,6-7,9-11H2,1H3,(H,26,27)(H2,22,23,24);1H |
| InChIKey | POUOLZLQUXNLKS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|