C18H24FN5O — CID 111887809
N-cyclopropyl-2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]acetamide (PubChem CID 111887809) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is N-cyclopropyl-2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]acetamide.
| Compound Name | N-cyclopropyl-2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111887809 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-cyclopropyl-2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC1CC1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H24FN5O/c1-2-20-18(23-11-17(25)24-14-4-5-14)21-8-7-12-10-22-16-9-13(19)3-6-15(12)16/h3,6,9-10,14,22H,2,4-5,7-8,11H2,1H3,(H,24,25)(H2,20,21,23) |
| InChIKey | UBQPCQINVNKADQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|