C23H29FIN5O2 — CID 111887856
2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 111887856) has the molecular formula C23H29FIN5O2 and a molecular weight of 553.42 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111887856 |
| Molecular Formula | C23H29FIN5O2 |
| Molecular Weight | 553.42 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[[ethylamino-[2-(6-fluoro-1H-indol-3-yl)ethylamino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C23H28FN5O2.HI/c1-3-25-23(26-11-10-17-14-27-21-12-18(24)6-9-20(17)21)29-15-22(30)28-13-16-4-7-19(31-2)8-5-16;/h4-9,12,14,27H,3,10-11,13,15H2,1-2H3,(H,28,30)(H2,25,26,29);1H |
| InChIKey | ZWGHBXSROFDCGC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|