C23H30FIN4O3 — CID 111377466
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111377466) has the molecular formula C23H30FIN4O3 and a molecular weight of 556.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111377466 |
| Molecular Formula | C23H30FIN4O3 |
| Molecular Weight | 556.42 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(3,4,5-trimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)c(OC)c1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C23H29FN4O3.HI/c1-5-25-23(26-9-8-16-14-27-19-12-17(24)6-7-18(16)19)28-13-15-10-20(29-2)22(31-4)21(11-15)30-3;/h6-7,10-12,14,27H,5,8-9,13H2,1-4H3,(H2,25,26,28);1H |
| InChIKey | CBURICIDNAFIQE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|