C25H33FN4O2 — CID 111888071
2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111888071) has the molecular formula C25H33FN4O2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111888071 |
| Molecular Formula | C25H33FN4O2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(COCCOCC)c1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C25H33FN4O2/c1-3-27-25(28-11-10-21-17-29-24-15-22(26)8-9-23(21)24)30-16-19-6-5-7-20(14-19)18-32-13-12-31-4-2/h5-9,14-15,17,29H,3-4,10-13,16,18H2,1-2H3,(H2,27,28,30) |
| InChIKey | IFFRVDGXNCEJQC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|