C22H29F2N3O2 — CID 111901997
1-[(2,5-difluorophenyl)methyl]-2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-ethylguanidine (PubChem CID 111901997) has the molecular formula C22H29F2N3O2 and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-ethylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111901997 |
| Molecular Formula | C22H29F2N3O2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-[[3-(2-ethoxyethoxymethyl)phenyl]methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cccc(COCCOCC)c1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C22H29F2N3O2/c1-3-25-22(27-15-19-13-20(23)8-9-21(19)24)26-14-17-6-5-7-18(12-17)16-29-11-10-28-4-2/h5-9,12-13H,3-4,10-11,14-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | UMUYDEMBEWPJGV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|