C17H19F3IN3 — CID 111782883
1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 111782883) has the molecular formula C17H19F3IN3 and a molecular weight of 449.26 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111782883 |
| Molecular Formula | C17H19F3IN3 |
| Molecular Weight | 449.26 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-fluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C17H18F3N3.HI/c1-2-21-17(22-10-12-3-5-14(18)6-4-12)23-11-13-9-15(19)7-8-16(13)20;/h3-9H,2,10-11H2,1H3,(H2,21,22,23);1H |
| InChIKey | GMRLCGUHZCIMIP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|