C17H19F2IN4O2 — CID 111901666
1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111901666) has the molecular formula C17H19F2IN4O2 and a molecular weight of 476.27 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111901666 |
| Molecular Formula | C17H19F2IN4O2 |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C17H18F2N4O2.HI/c1-2-20-17(22-11-13-9-14(18)5-8-16(13)19)21-10-12-3-6-15(7-4-12)23(24)25;/h3-9H,2,10-11H2,1H3,(H2,20,21,22);1H |
| InChIKey | PFNXVECIIFCIIX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|