C18H21F2IN4O — CID 111902500
4-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111902500) has the molecular formula C18H21F2IN4O and a molecular weight of 474.29 g/mol. Its IUPAC name is 4-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111902500 |
| Molecular Formula | C18H21F2IN4O |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4-[[[[(2,5-difluorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(N)=O)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C18H20F2N4O.HI/c1-2-22-18(24-11-14-9-15(19)7-8-16(14)20)23-10-12-3-5-13(6-4-12)17(21)25;/h3-9H,2,10-11H2,1H3,(H2,21,25)(H2,22,23,24);1H |
| InChIKey | LBLUXLVZRJWTBU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|