C19H23FN4O — CID 111844451
4-[[[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111844451) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[[[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111844451 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-[[[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H23FN4O/c1-3-22-19(24-12-15-5-4-13(2)17(20)10-15)23-11-14-6-8-16(9-7-14)18(21)25/h4-10H,3,11-12H2,1-2H3,(H2,21,25)(H2,22,23,24) |
| InChIKey | OGWXTRNXJKJIJV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|