C13H21FN4O2S — CID 111846475
1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine (PubChem CID 111846475) has the molecular formula C13H21FN4O2S and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine |
|---|---|
| PubChem CID | 111846475 |
| Molecular Formula | C13H21FN4O2S |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-(2-sulfamoylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCCS(N)(=O)=O |
| InChI | InChI=1S/C13H21FN4O2S/c1-3-16-13(17-6-7-21(15,19)20)18-9-11-5-4-10(2)12(14)8-11/h4-5,8H,3,6-7,9H2,1-2H3,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | GXRWRNPHHMVADJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|