C16H22FIN4O2S2 — CID 111846498
1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111846498) has the molecular formula C16H22FIN4O2S2 and a molecular weight of 512.41 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111846498 |
| Molecular Formula | C16H22FIN4O2S2 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 1-ethyl-2-[(3-fluoro-4-methylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C16H21FN4O2S2.HI/c1-3-19-16(20-9-12-5-4-11(2)14(17)8-12)21-10-13-6-7-15(24-13)25(18,22)23;/h4-8H,3,9-10H2,1-2H3,(H2,18,22,23)(H2,19,20,21);1H |
| InChIKey | UNIJEKCISMWJMA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|