C14H20N4O2S3 — CID 111897471
1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111897471) has the molecular formula C14H20N4O2S3 and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111897471 |
| Molecular Formula | C14H20N4O2S3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-ethyl-2-[(5-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C)s1)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C14H20N4O2S3/c1-3-16-14(17-8-11-5-4-10(2)21-11)18-9-12-6-7-13(22-12)23(15,19)20/h4-7H,3,8-9H2,1-2H3,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | NKSWPNOUZTYUTC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|