C12H20N4O2S2 — CID 111962285
1-ethyl-3-(2-methylcyclopropyl)-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111962285) has the molecular formula C12H20N4O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-ethyl-3-(2-methylcyclopropyl)-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-methylcyclopropyl)-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111962285 |
| Molecular Formula | C12H20N4O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-ethyl-3-(2-methylcyclopropyl)-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NC1CC1C |
| InChI | InChI=1S/C12H20N4O2S2/c1-3-14-12(16-10-6-8(10)2)15-7-9-4-5-11(19-9)20(13,17)18/h4-5,8,10H,3,6-7H2,1-2H3,(H2,13,17,18)(H2,14,15,16) |
| InChIKey | ZHCVPCGIOGRUSS-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|