C15H26N4O3S2 — CID 111390951
1-[3-(cyclopropylmethoxy)propyl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111390951) has the molecular formula C15H26N4O3S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)propyl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(cyclopropylmethoxy)propyl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111390951 |
| Molecular Formula | C15H26N4O3S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)propyl]-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCCCOCC1CC1 |
| InChI | InChI=1S/C15H26N4O3S2/c1-2-17-15(18-8-3-9-22-11-12-4-5-12)19-10-13-6-7-14(23-13)24(16,20)21/h6-7,12H,2-5,8-11H2,1H3,(H2,16,20,21)(H2,17,18,19) |
| InChIKey | QRXSESHCZYLRTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|