C13H25IN4O3S2 — CID 111221962
1-(3-ethoxypropyl)-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111221962) has the molecular formula C13H25IN4O3S2 and a molecular weight of 476.41 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111221962 |
| Molecular Formula | C13H25IN4O3S2 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-ethyl-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCCCOCC.I |
| InChI | InChI=1S/C13H24N4O3S2.HI/c1-3-15-13(16-8-5-9-20-4-2)17-10-11-6-7-12(21-11)22(14,18)19;/h6-7H,3-5,8-10H2,1-2H3,(H2,14,18,19)(H2,15,16,17);1H |
| InChIKey | MMAVEZKPHGJDCO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|