C17H29N3O3S — CID 111222671
1-(3-ethoxypropyl)-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine (PubChem CID 111222671) has the molecular formula C17H29N3O3S and a molecular weight of 355.50 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111222671 |
| Molecular Formula | C17H29N3O3S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-ethyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(CS(C)(=O)=O)cc1)NCCCOCC |
| InChI | InChI=1S/C17H29N3O3S/c1-4-18-17(19-11-6-12-23-5-2)20-13-15-7-9-16(10-8-15)14-24(3,21)22/h7-10H,4-6,11-14H2,1-3H3,(H2,18,19,20) |
| InChIKey | YXGZHNMAAWVONK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|