C19H32N4O2 — CID 111224573
N-[4-[[[(3-ethoxypropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]butanamide (PubChem CID 111224573) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[4-[[[(3-ethoxypropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]butanamide.
| Compound Name | N-[4-[[[(3-ethoxypropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 111224573 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | N-[4-[[[(3-ethoxypropylamino)-(ethylamino)methylidene]amino]methyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C/N=C(\NCC)NCCCOCC)cc1 |
| InChI | InChI=1S/C19H32N4O2/c1-4-8-18(24)23-17-11-9-16(10-12-17)15-22-19(20-5-2)21-13-7-14-25-6-3/h9-12H,4-8,13-15H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | ZVPRHPQNFUINAI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|