C19H29IN4O3S2 — CID 111402878
1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111402878) has the molecular formula C19H29IN4O3S2 and a molecular weight of 552.50 g/mol. Its IUPAC name is 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111402878 |
| Molecular Formula | C19H29IN4O3S2 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.07 |
| IUPAC Name | 1-ethyl-3-[3-(1-phenylethoxy)propyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCCCOC(C)c1ccccc1.I |
| InChI | InChI=1S/C19H28N4O3S2.HI/c1-3-21-19(23-14-17-10-11-18(27-17)28(20,24)25)22-12-7-13-26-15(2)16-8-5-4-6-9-16;/h4-6,8-11,15H,3,7,12-14H2,1-2H3,(H2,20,24,25)(H2,21,22,23);1H |
| InChIKey | BARBDEKDZQHXMJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|